C24H22F3N7O2 — CID 172696423
7-N,7-N,2-trimethyl-4-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-pyridin-4-ylpyrido[2,3-d]pyrimidine-4,7-diamine (PubChem CID 172696423) has the molecular formula C24H22F3N7O2 and a molecular weight of 497.48 g/mol. Its IUPAC name is 7-N,7-N,2-trimethyl-4-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-pyridin-4-ylpyrido[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 7-N,7-N,2-trimethyl-4-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-pyridin-4-ylpyrido[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 172696423 |
| Molecular Formula | C24H22F3N7O2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 7-N,7-N,2-trimethyl-4-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-pyridin-4-ylpyrido[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(-c3ccncc3)c(N(C)C)nc2n1 |
| InChI | InChI=1S/C24H22F3N7O2/c1-13(16-9-17(24(25,26)27)11-18(10-16)34(35)36)29-21-20-12-19(15-5-7-28-8-6-15)23(33(3)4)32-22(20)31-14(2)30-21/h5-13H,1-4H3,(H,29,30,31,32)/t13-/m1/s1 |
| InChIKey | CJNPKXXWTBSUQL-CYBMUJFWSA-N |
| XLogP | 5.56 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|