C17H14BrF3N4 — CID 175277359
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-bromoquinazolin-4-amine (PubChem CID 175277359) has the molecular formula C17H14BrF3N4 and a molecular weight of 411.23 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-bromoquinazolin-4-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-bromoquinazolin-4-amine |
|---|---|
| PubChem CID | 175277359 |
| Molecular Formula | C17H14BrF3N4 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-bromoquinazolin-4-amine |
| SMILES | CC(Nc1ncnc2ccc(Br)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14BrF3N4/c1-9(10-4-11(17(19,20)21)6-13(22)5-10)25-16-14-7-12(18)2-3-15(14)23-8-24-16/h2-9H,22H2,1H3,(H,23,24,25) |
| InChIKey | RXSJDEBSCSWMTF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|