C19H18F4N4O2S — CID 168898857
tert-butyl 6-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylimidazo[4,5-b]pyridine-3-carboxylate (PubChem CID 168898857) has the molecular formula C19H18F4N4O2S and a molecular weight of 442.44 g/mol. Its IUPAC name is tert-butyl 6-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylimidazo[4,5-b]pyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylimidazo[4,5-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168898857 |
| Molecular Formula | C19H18F4N4O2S |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | tert-butyl 6-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylimidazo[4,5-b]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc2cc(SNC(c3ccc(F)cc3)C(F)(F)F)cnc21 |
| InChI | InChI=1S/C19H18F4N4O2S/c1-18(2,3)29-17(28)27-10-25-14-8-13(9-24-16(14)27)30-26-15(19(21,22)23)11-4-6-12(20)7-5-11/h4-10,15,26H,1-3H3 |
| InChIKey | AAARWNGWEBDODE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|