C17H16F3N3S — CID 177189552
5-[ethyl-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile (PubChem CID 177189552) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is 5-[ethyl-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile.
| Compound Name | 5-[ethyl-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 177189552 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-[ethyl-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
| SMILES | CCN(Sc1cncc(C#N)c1)C(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3N3S/c1-3-23(24-16-8-13(9-21)10-22-11-16)12(2)14-4-6-15(7-5-14)17(18,19)20/h4-8,10-12H,3H2,1-2H3 |
| InChIKey | HECDMYZFJCCKBT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|