C15H13ClF4N2S — CID 177189570
1-(4-chlorophenyl)-N-ethyl-2,2,2-trifluoro-N-[(5-fluoro-3-pyridinyl)sulfanyl]ethanamine (PubChem CID 177189570) has the molecular formula C15H13ClF4N2S and a molecular weight of 364.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-ethyl-2,2,2-trifluoro-N-[(5-fluoro-3-pyridinyl)sulfanyl]ethanamine.
| Compound Name | 1-(4-chlorophenyl)-N-ethyl-2,2,2-trifluoro-N-[(5-fluoro-3-pyridinyl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 177189570 |
| Molecular Formula | C15H13ClF4N2S |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(4-chlorophenyl)-N-ethyl-2,2,2-trifluoro-N-[(5-fluoro-3-pyridinyl)sulfanyl]ethanamine |
| SMILES | CCN(Sc1cncc(F)c1)C(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H13ClF4N2S/c1-2-22(23-13-7-12(17)8-21-9-13)14(15(18,19)20)10-3-5-11(16)6-4-10/h3-9,14H,2H2,1H3 |
| InChIKey | MUUUMQSUSLEHAN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|