C21H30BN3O6S — CID 171803603
3-tert-butyl-N-[[2-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 171803603) has the molecular formula C21H30BN3O6S and a molecular weight of 463.37 g/mol. Its IUPAC name is 3-tert-butyl-N-[[2-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[[2-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 171803603 |
| Molecular Formula | C21H30BN3O6S |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-tert-butyl-N-[[2-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1noc(C(=O)NCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2S(C)(=O)=O)n1 |
| InChI | InChI=1S/C21H30BN3O6S/c1-19(2,3)18-24-17(29-25-18)16(26)23-12-13-9-10-14(11-15(13)32(8,27)28)22-30-20(4,5)21(6,7)31-22/h9-11H,12H2,1-8H3,(H,23,26) |
| InChIKey | PSFJNKNFIWWWBR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|