C22H33BClN3O4 — CID 171803793
3-tert-butyl-N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane (PubChem CID 171803793) has the molecular formula C22H33BClN3O4 and a molecular weight of 449.79 g/mol. Its IUPAC name is 3-tert-butyl-N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane.
| Compound Name | 3-tert-butyl-N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 171803793 |
| Molecular Formula | C22H33BClN3O4 |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 3-tert-butyl-N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide;ethane |
| SMILES | CC.CC(C)(C)c1noc(C(=O)NCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2Cl)n1 |
| InChI | InChI=1S/C20H27BClN3O4.C2H6/c1-18(2,3)17-24-16(27-25-17)15(26)23-11-12-8-9-13(10-14(12)22)21-28-19(4,5)20(6,7)29-21;1-2/h8-10H,11H2,1-7H3,(H,23,26);1-2H3 |
| InChIKey | PUXYVKKIUPTPCQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|