C21H28BN3O4 — CID 162725275
5-(1-methylcyclopropyl)-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 162725275) has the molecular formula C21H28BN3O4 and a molecular weight of 397.28 g/mol. Its IUPAC name is 5-(1-methylcyclopropyl)-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-(1-methylcyclopropyl)-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 162725275 |
| Molecular Formula | C21H28BN3O4 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 5-(1-methylcyclopropyl)-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CNC(=O)c1noc(C2(C)CC2)n1 |
| InChI | InChI=1S/C21H28BN3O4/c1-13-11-15(22-28-19(2,3)20(4,5)29-22)8-7-14(13)12-23-17(26)16-24-18(27-25-16)21(6)9-10-21/h7-8,11H,9-10,12H2,1-6H3,(H,23,26) |
| InChIKey | DZFPLGDHYWHIBS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|