C20H32BN5O3 — CID 162725371
(2Z)-2-(tert-butyldiazenyl)-2-hydrazinylidene-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide (PubChem CID 162725371) has the molecular formula C20H32BN5O3 and a molecular weight of 401.32 g/mol. Its IUPAC name is (2Z)-2-(tert-butyldiazenyl)-2-hydrazinylidene-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide.
| Compound Name | (2Z)-2-(tert-butyldiazenyl)-2-hydrazinylidene-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 162725371 |
| Molecular Formula | C20H32BN5O3 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (2Z)-2-(tert-butyldiazenyl)-2-hydrazinylidene-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CNC(=O)C(=N/N)/N=N/C(C)(C)C |
| InChI | InChI=1S/C20H32BN5O3/c1-13-11-15(21-28-19(5,6)20(7,8)29-21)10-9-14(13)12-23-17(27)16(24-22)25-26-18(2,3)4/h9-11H,12,22H2,1-8H3,(H,23,27)/b24-16-,26-25+ |
| InChIKey | GFJMXXQLWOEQCF-SFFYKXJYSA-N |
| XLogP | 2.43 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|