C22H31BN2O4 — CID 162725070
5-tert-butyl-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 162725070) has the molecular formula C22H31BN2O4 and a molecular weight of 398.31 g/mol. Its IUPAC name is 5-tert-butyl-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162725070 |
| Molecular Formula | C22H31BN2O4 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 5-tert-butyl-N-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CNC(=O)c1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C22H31BN2O4/c1-14-11-16(23-28-21(5,6)22(7,8)29-23)10-9-15(14)13-24-19(26)17-12-18(27-25-17)20(2,3)4/h9-12H,13H2,1-8H3,(H,24,26) |
| InChIKey | ZHKJSDJNLPETCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|