C25H31BCl2FNO6S — CID 170526630
[2,5-dichloro-3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]phenyl]methyl 2,2-dimethylbutanoate (PubChem CID 170526630) has the molecular formula C25H31BCl2FNO6S and a molecular weight of 574.31 g/mol. Its IUPAC name is [2,5-dichloro-3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]phenyl]methyl 2,2-dimethylbutanoate.
| Compound Name | [2,5-dichloro-3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]phenyl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 170526630 |
| Molecular Formula | C25H31BCl2FNO6S |
| Molecular Weight | 574.31 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | [2,5-dichloro-3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]phenyl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCc1cc(Cl)cc(S(=O)(=O)Nc2cccc(B3OC(C)(C)C(C)(C)O3)c2F)c1Cl |
| InChI | InChI=1S/C25H31BCl2FNO6S/c1-8-23(2,3)22(31)34-14-15-12-16(27)13-19(20(15)28)37(32,33)30-18-11-9-10-17(21(18)29)26-35-24(4,5)25(6,7)36-26/h9-13,30H,8,14H2,1-7H3 |
| InChIKey | CQRIZJNCXSHVTA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|