C25H23BF4N2O5S — CID 175189563
4-fluoro-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 175189563) has the molecular formula C25H23BF4N2O5S and a molecular weight of 550.34 g/mol. Its IUPAC name is 4-fluoro-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 175189563 |
| Molecular Formula | C25H23BF4N2O5S |
| Molecular Weight | 550.34 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-fluoro-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1(C)OB(c2cccc(NS(=O)(=O)c3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3F)c2)OC1(C)C |
| InChI | InChI=1S/C25H23BF4N2O5S/c1-24(2)25(3,4)37-26(36-24)15-6-5-7-16(11-15)32-38(34,35)21-10-14(8-9-18(21)27)23(33)31-17-12-19(28)22(30)20(29)13-17/h5-13,32H,1-4H3,(H,31,33) |
| InChIKey | MCTXQSQNYMTGGX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|