C24H30BNO4 — CID 171853439
(E)-3-(dimethylamino)-1-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one (PubChem CID 171853439) has the molecular formula C24H30BNO4 and a molecular weight of 407.32 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171853439 |
| Molecular Formula | C24H30BNO4 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (E)-3-(dimethylamino)-1-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one |
| SMILES | CN(C)/C=C/C(=O)c1ccc(OCc2ccccc2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C24H30BNO4/c1-23(2)24(3,4)30-25(29-23)20-16-19(21(27)14-15-26(5)6)12-13-22(20)28-17-18-10-8-7-9-11-18/h7-16H,17H2,1-6H3/b15-14+ |
| InChIKey | SIAJAEMJLGGGPV-CCEZHUSRSA-N |
| XLogP | 3.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|