C21H28BNO5S — CID 166594078
N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (PubChem CID 166594078) has the molecular formula C21H28BNO5S and a molecular weight of 417.34 g/mol. Its IUPAC name is N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 166594078 |
| Molecular Formula | C21H28BNO5S |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(OCc2ccccc2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H28BNO5S/c1-6-29(24,25)23-17-12-13-19(26-15-16-10-8-7-9-11-16)18(14-17)22-27-20(2,3)21(4,5)28-22/h7-14,23H,6,15H2,1-5H3 |
| InChIKey | DNXNRPREFLLLFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|