C23H30BClO3 — CID 164895231
2-(5-tert-butyl-2-chloro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164895231) has the molecular formula C23H30BClO3 and a molecular weight of 400.76 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-chloro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(5-tert-butyl-2-chloro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164895231 |
| Molecular Formula | C23H30BClO3 |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-(5-tert-butyl-2-chloro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)c1cc(OCc2ccccc2)c(Cl)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C23H30BClO3/c1-21(2,3)17-13-18(24-27-22(4,5)23(6,7)28-24)20(25)19(14-17)26-15-16-11-9-8-10-12-16/h8-14H,15H2,1-7H3 |
| InChIKey | GQEHJVWKTJLWGJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|