About 5-octoxypyridin-3-amine
5-octoxypyridin-3-amine (PubChem CID 104536057) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-octoxypyridin-3-amine.
Molecular Properties
| Compound Name | 5-octoxypyridin-3-amine |
| PubChem CID | 104536057 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 5-octoxypyridin-3-amine |
| SMILES | CCCCCCCCOc1cncc(N)c1 |
| InChI | InChI=1S/C13H22N2O/c1-2-3-4-5-6-7-8-16-13-9-12(14)10-15-11-13/h9-11H,2-8,14H2,1H3 |
| InChIKey | XGGJAJJEKHEJHY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-octoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-octoxypyridin-3-amine?
The IUPAC name of 5-octoxypyridin-3-amine (CID 104536057) is 5-octoxypyridin-3-amine.
What is the SMILES notation for 5-octoxypyridin-3-amine?
The canonical SMILES for 5-octoxypyridin-3-amine is CCCCCCCCOc1cncc(N)c1.
What is the InChIKey of 5-octoxypyridin-3-amine?
The InChIKey is XGGJAJJEKHEJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-2-3-4-5-6-7-8-16-13-9-12(14)10-15-11-13/h9-11H,2-8,14H2,1H3.
What are the key properties of 5-octoxypyridin-3-amine?
5-octoxypyridin-3-amine has a molecular weight of 222.33 g/mol, XLogP of 3.40, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-octoxypyridin-3-amine is sourced from PubChem (CID 104536057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).