C49H55N3O — CID 102597851
7-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-9,9-dihexyl-N,N-diphenylfluoren-2-amine (PubChem CID 102597851) has the molecular formula C49H55N3O and a molecular weight of 702.00 g/mol. Its IUPAC name is 7-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-9,9-dihexyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-9,9-dihexyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 102597851 |
| Molecular Formula | C49H55N3O |
| Molecular Weight | 702.00 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | 7-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-9,9-dihexyl-N,N-diphenylfluoren-2-amine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C49H55N3O/c1-6-8-10-18-32-49(33-19-11-9-7-2)44-34-37(47-51-50-46(53-47)36-24-27-38(28-25-36)48(3,4)5)26-30-42(44)43-31-29-41(35-45(43)49)52(39-20-14-12-15-21-39)40-22-16-13-17-23-40/h12-17,20-31,34-35H,6-11,18-19,32-33H2,1-5H3 |
| InChIKey | RYHIAEQFCSKKPO-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.00 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|