C62H48Cl2N4O — CID 139089806
2-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-2-N',2-N',7-N',7-N'-tetraphenyl-9,9'-spirobi[fluorene]-2',7'-diamine;dichloromethane (PubChem CID 139089806) has the molecular formula C62H48Cl2N4O and a molecular weight of 936.00 g/mol. Its IUPAC name is 2-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-2-N',2-N',7-N',7-N'-tetraphenyl-9,9'-spirobi[fluorene]-2',7'-diamine;dichloromethane.
| Compound Name | 2-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-2-N',2-N',7-N',7-N'-tetraphenyl-9,9'-spirobi[fluorene]-2',7'-diamine;dichloromethane |
|---|---|
| PubChem CID | 139089806 |
| Molecular Formula | C62H48Cl2N4O |
| Molecular Weight | 936.00 g/mol |
| Exact Mass | 934.32 |
| IUPAC Name | 2-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-2-N',2-N',7-N',7-N'-tetraphenyl-9,9'-spirobi[fluorene]-2',7'-diamine;dichloromethane |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc4c(c3)C3(c5ccccc5-4)c4cc(N(c5ccccc5)c5ccccc5)ccc4-c4ccc(N(c5ccccc5)c5ccccc5)cc43)o2)cc1.ClCCl |
| InChI | InChI=1S/C61H46N4O.CH2Cl2/c1-60(2,3)43-31-28-41(29-32-43)58-62-63-59(66-58)42-30-35-51-50-26-16-17-27-54(50)61(55(51)38-42)56-39-48(64(44-18-8-4-9-19-44)45-20-10-5-11-21-45)33-36-52(56)53-37-34-49(40-57(53)61)65(46-22-12-6-13-23-46)47-24-14-7-15-25-47;2-1-3/h4-40H,1-3H3;1H2 |
| InChIKey | GIJYDIFAPMOGDT-UHFFFAOYSA-N |
| XLogP | 17.41 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.00 |
| LogP ≤ 5 | 17.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|