C14H9Cl2N3 — CID 11077118
3-chloro-5-(4-chlorophenyl)-4-phenyl-1,2,4-triazole (PubChem CID 11077118) has the molecular formula C14H9Cl2N3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-chloro-5-(4-chlorophenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-chloro-5-(4-chlorophenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 11077118 |
| Molecular Formula | C14H9Cl2N3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-chloro-5-(4-chlorophenyl)-4-phenyl-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nnc(Cl)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9Cl2N3/c15-11-8-6-10(7-9-11)13-17-18-14(16)19(13)12-4-2-1-3-5-12/h1-9H |
| InChIKey | ZPZIVTFVCZFPJV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |