C23H19ClN6S — CID 10928427
2-[(benzylamino)methyl]-6-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazole-3-thione (PubChem CID 10928427) has the molecular formula C23H19ClN6S and a molecular weight of 446.97 g/mol. Its IUPAC name is 2-[(benzylamino)methyl]-6-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazole-3-thione.
| Compound Name | 2-[(benzylamino)methyl]-6-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 10928427 |
| Molecular Formula | C23H19ClN6S |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[(benzylamino)methyl]-6-(4-chlorophenyl)-7-phenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazole-3-thione |
| SMILES | S=c1n(CNCc2ccccc2)nc2n(-c3ccccc3)c(-c3ccc(Cl)cc3)nn12 |
| InChI | InChI=1S/C23H19ClN6S/c24-19-13-11-18(12-14-19)21-26-30-22(29(21)20-9-5-2-6-10-20)27-28(23(30)31)16-25-15-17-7-3-1-4-8-17/h1-14,25H,15-16H2 |
| InChIKey | QTIKBUQXGTUZHV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|