C28H13Cl2F2N3O6 — CID 158663504
2-(4-chloro-2-fluoro-5-nitrophenyl)isoindole-1,3-dione;2-(4-chloro-2-fluorophenyl)isoindole-1,3-dione (PubChem CID 158663504) has the molecular formula C28H13Cl2F2N3O6 and a molecular weight of 596.33 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-nitrophenyl)isoindole-1,3-dione;2-(4-chloro-2-fluorophenyl)isoindole-1,3-dione.
| Compound Name | 2-(4-chloro-2-fluoro-5-nitrophenyl)isoindole-1,3-dione;2-(4-chloro-2-fluorophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158663504 |
| Molecular Formula | C28H13Cl2F2N3O6 |
| Molecular Weight | 596.33 g/mol |
| Exact Mass | 595.01 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-nitrophenyl)isoindole-1,3-dione;2-(4-chloro-2-fluorophenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc([N+](=O)[O-])c(Cl)cc1F.O=C1c2ccccc2C(=O)N1c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H6ClFN2O4.C14H7ClFNO2/c15-9-5-10(16)12(6-11(9)18(21)22)17-13(19)7-3-1-2-4-8(7)14(17)20;15-8-5-6-12(11(16)7-8)17-13(18)9-3-1-2-4-10(9)14(17)19/h1-6H;1-7H |
| InChIKey | IDBBQEFOXBQGPT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.33 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|