C19H24N2O — CID 143637065
5-[[(E)-6,6-dimethyl-4-methylidenehept-2-en-2-yl]amino]-2H-isoquinolin-3-one (PubChem CID 143637065) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-[[(E)-6,6-dimethyl-4-methylidenehept-2-en-2-yl]amino]-2H-isoquinolin-3-one.
| Compound Name | 5-[[(E)-6,6-dimethyl-4-methylidenehept-2-en-2-yl]amino]-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 143637065 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 5-[[(E)-6,6-dimethyl-4-methylidenehept-2-en-2-yl]amino]-2H-isoquinolin-3-one |
| SMILES | C=C(/C=C(\C)Nc1cccc2c[nH]c(=O)cc12)CC(C)(C)C |
| InChI | InChI=1S/C19H24N2O/c1-13(11-19(3,4)5)9-14(2)21-17-8-6-7-15-12-20-18(22)10-16(15)17/h6-10,12,21H,1,11H2,2-5H3,(H,20,22)/b14-9+ |
| InChIKey | VBLHAJOMYPFJBF-NTEUORMPSA-N |
| XLogP | 4.84 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|