C15H17N3O3S — CID 19188920
N-(tert-butylcarbamothioyl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 19188920) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(tert-butylcarbamothioyl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(tert-butylcarbamothioyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 19188920 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(tert-butylcarbamothioyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(C)(C)NC(=S)NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17N3O3S/c1-15(2,3)17-14(22)16-11(19)8-18-12(20)9-6-4-5-7-10(9)13(18)21/h4-7H,8H2,1-3H3,(H2,16,17,19,22) |
| InChIKey | MPZBQJHPYBBDGR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|