C18H12F3N3O3S — CID 19189022
2-(1,3-dioxoisoindol-2-yl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]acetamide (PubChem CID 19189022) has the molecular formula C18H12F3N3O3S and a molecular weight of 407.37 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 19189022 |
| Molecular Formula | C18H12F3N3O3S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3O3S/c19-18(20,21)12-7-3-4-8-13(12)22-17(28)23-14(25)9-24-15(26)10-5-1-2-6-11(10)16(24)27/h1-8H,9H2,(H2,22,23,25,28) |
| InChIKey | QODSHVLJSPCWRG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|