C18H17F3N2O2S — CID 19188424
4-phenoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]butanamide (PubChem CID 19188424) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-phenoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]butanamide.
| Compound Name | 4-phenoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188424 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-phenoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)NC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2S/c19-18(20,21)14-9-4-5-10-15(14)22-17(26)23-16(24)11-6-12-25-13-7-2-1-3-8-13/h1-5,7-10H,6,11-12H2,(H2,22,23,24,26) |
| InChIKey | MIDZUIFNPMROMA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|