C20H22N2O4S — CID 19188564
methyl 2-[4-(4-methylphenoxy)butanoylcarbamothioylamino]benzoate (PubChem CID 19188564) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is methyl 2-[4-(4-methylphenoxy)butanoylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-[4-(4-methylphenoxy)butanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19188564 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | methyl 2-[4-(4-methylphenoxy)butanoylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-14-9-11-15(12-10-14)26-13-5-8-18(23)22-20(27)21-17-7-4-3-6-16(17)19(24)25-2/h3-4,6-7,9-12H,5,8,13H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | CCHKEYJGFJQKQM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|