C26H36N4O3S — CID 161463574
N-(tert-butylcarbamothioyl)-2-phenylacetamide;N-(tert-butylcarbamoyl)-2-phenylacetamide (PubChem CID 161463574) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-(tert-butylcarbamothioyl)-2-phenylacetamide;N-(tert-butylcarbamoyl)-2-phenylacetamide.
| Compound Name | N-(tert-butylcarbamothioyl)-2-phenylacetamide;N-(tert-butylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 161463574 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-(tert-butylcarbamothioyl)-2-phenylacetamide;N-(tert-butylcarbamoyl)-2-phenylacetamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)Cc1ccccc1.CC(C)(C)NC(=S)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H18N2O2.C13H18N2OS/c2*1-13(2,3)15-12(17)14-11(16)9-10-7-5-4-6-8-10/h2*4-8H,9H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | WCDCWPYESVUQNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|