C21H23N3O4 — CID 69020733
[(2S)-1-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-2-(pyridin-3-ylmethyl)butan-2-yl]carbamic acid (PubChem CID 69020733) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(2S)-1-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-2-(pyridin-3-ylmethyl)butan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-2-(pyridin-3-ylmethyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69020733 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [(2S)-1-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-2-(pyridin-3-ylmethyl)butan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[C@@](Cc1cccnc1)(CN1C(=O)c2ccccc2C1=O)NC(=O)O |
| InChI | InChI=1S/C21H23N3O4/c1-20(2,3)21(23-19(27)28,11-14-7-6-10-22-12-14)13-24-17(25)15-8-4-5-9-16(15)18(24)26/h4-10,12,23H,11,13H2,1-3H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | WSYRAIUONKTWMG-OAQYLSRUSA-N |
| XLogP | 2.97 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|