C15H22BrClNO3P — CID 12630698
(Z)-3-(4-bromophenyl)-3-chloro-1-diethoxyphosphoryl-N,N-dimethylprop-2-en-1-amine (PubChem CID 12630698) has the molecular formula C15H22BrClNO3P and a molecular weight of 410.68 g/mol. Its IUPAC name is (Z)-3-(4-bromophenyl)-3-chloro-1-diethoxyphosphoryl-N,N-dimethylprop-2-en-1-amine.
| Compound Name | (Z)-3-(4-bromophenyl)-3-chloro-1-diethoxyphosphoryl-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 12630698 |
| Molecular Formula | C15H22BrClNO3P |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (Z)-3-(4-bromophenyl)-3-chloro-1-diethoxyphosphoryl-N,N-dimethylprop-2-en-1-amine |
| SMILES | CCOP(=O)(OCC)C(/C=C(\Cl)c1ccc(Br)cc1)N(C)C |
| InChI | InChI=1S/C15H22BrClNO3P/c1-5-20-22(19,21-6-2)15(18(3)4)11-14(17)12-7-9-13(16)10-8-12/h7-11,15H,5-6H2,1-4H3/b14-11- |
| InChIKey | ZGLZTKBZSIIJCD-KAMYIIQDSA-N |
| XLogP | 5.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|