C46H50BrO10P — CID 10795731
[(1S)-1-diethoxyphosphoryl-2-[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethyl] 4-bromobenzoate (PubChem CID 10795731) has the molecular formula C46H50BrO10P and a molecular weight of 873.77 g/mol. Its IUPAC name is [(1S)-1-diethoxyphosphoryl-2-[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethyl] 4-bromobenzoate.
| Compound Name | [(1S)-1-diethoxyphosphoryl-2-[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 10795731 |
| Molecular Formula | C46H50BrO10P |
| Molecular Weight | 873.77 g/mol |
| Exact Mass | 872.23 |
| IUPAC Name | [(1S)-1-diethoxyphosphoryl-2-[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethyl] 4-bromobenzoate |
| SMILES | CCOP(=O)(OCC)[C@@H](C[C@H]1O[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C46H50BrO10P/c1-3-54-58(49,55-4-2)41(57-45(48)38-25-27-39(47)28-26-38)29-40-42(50-30-34-17-9-5-10-18-34)43(51-31-35-19-11-6-12-20-35)44(52-32-36-21-13-7-14-22-36)46(56-40)53-33-37-23-15-8-16-24-37/h5-28,40-44,46H,3-4,29-33H2,1-2H3/t40-,41+,42-,43+,44-,46-/m1/s1 |
| InChIKey | ODNRBHQVLSJSHS-SZBPRHEKSA-N |
| XLogP | 10.29 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.77 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|