C39H46FO8P — CID 10532677
(2R,3R,4S,5R,6R)-2-[(2S)-2-diethoxyphosphoryl-2-fluoroethyl]-3,4,5,6-tetrakis(phenylmethoxy)oxane (PubChem CID 10532677) has the molecular formula C39H46FO8P and a molecular weight of 692.76 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(2S)-2-diethoxyphosphoryl-2-fluoroethyl]-3,4,5,6-tetrakis(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(2S)-2-diethoxyphosphoryl-2-fluoroethyl]-3,4,5,6-tetrakis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 10532677 |
| Molecular Formula | C39H46FO8P |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(2S)-2-diethoxyphosphoryl-2-fluoroethyl]-3,4,5,6-tetrakis(phenylmethoxy)oxane |
| SMILES | CCOP(=O)(OCC)[C@H](F)C[C@H]1O[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H46FO8P/c1-3-46-49(41,47-4-2)35(40)25-34-36(42-26-30-17-9-5-10-18-30)37(43-27-31-19-11-6-12-20-31)38(44-28-32-21-13-7-14-22-32)39(48-34)45-29-33-23-15-8-16-24-33/h5-24,34-39H,3-4,25-29H2,1-2H3/t34-,35+,36-,37+,38-,39-/m1/s1 |
| InChIKey | IOMYRTWWTMRTTJ-MNOZLBCTSA-N |
| XLogP | 8.64 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|