C16H20BrCl3NO6P — CID 72773808
2,2,2-trichloroethyl N-[3-(4-bromophenyl)-1-diethoxyphosphoryl-3-oxopropyl]carbamate (PubChem CID 72773808) has the molecular formula C16H20BrCl3NO6P and a molecular weight of 539.57 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-(4-bromophenyl)-1-diethoxyphosphoryl-3-oxopropyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-(4-bromophenyl)-1-diethoxyphosphoryl-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 72773808 |
| Molecular Formula | C16H20BrCl3NO6P |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 536.93 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-(4-bromophenyl)-1-diethoxyphosphoryl-3-oxopropyl]carbamate |
| SMILES | CCOP(=O)(OCC)C(CC(=O)c1ccc(Br)cc1)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20BrCl3NO6P/c1-3-26-28(24,27-4-2)14(21-15(23)25-10-16(18,19)20)9-13(22)11-5-7-12(17)8-6-11/h5-8,14H,3-4,9-10H2,1-2H3,(H,21,23) |
| InChIKey | NUEZWJAODXNBSR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|