C11H19Cl3NO6P — CID 87738261
butan-2-yloxy-[3-oxo-1-(2,2,2-trichloroethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 87738261) has the molecular formula C11H19Cl3NO6P and a molecular weight of 398.61 g/mol. Its IUPAC name is butan-2-yloxy-[3-oxo-1-(2,2,2-trichloroethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[3-oxo-1-(2,2,2-trichloroethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 87738261 |
| Molecular Formula | C11H19Cl3NO6P |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | butan-2-yloxy-[3-oxo-1-(2,2,2-trichloroethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(CC(C)=O)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3NO6P/c1-4-8(3)21-22(18,19)9(5-7(2)16)15-10(17)20-6-11(12,13)14/h8-9H,4-6H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | QVQSUKHCPFPDBN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|