C11H12Cl3NO4 — CID 135052899
[(E)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium perchlorate (PubChem CID 135052899) has the molecular formula C11H12Cl3NO4 and a molecular weight of 328.58 g/mol. Its IUPAC name is [(E)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium perchlorate.
| Compound Name | [(E)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 135052899 |
| Molecular Formula | C11H12Cl3NO4 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | [(E)-3-chloro-3-(4-chlorophenyl)prop-2-enylidene]-dimethylazanium perchlorate |
| SMILES | C[N+](C)=C/C=C(/Cl)c1ccc(Cl)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H12Cl2N.ClHO4/c1-14(2)8-7-11(13)9-3-5-10(12)6-4-9;2-1(3,4)5/h3-8H,1-2H3;(H,2,3,4,5)/q+1;/p-1/b11-7+; |
| InChIKey | DFIZVNKDKJZRBV-RVDQCCQOSA-M |
| XLogP | -1.49 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|