C14H15ClO — CID 13153107
(2Z)-2-(4-chlorophenyl)-6-methylhepta-2,5-dien-4-one (PubChem CID 13153107) has the molecular formula C14H15ClO and a molecular weight of 234.73 g/mol. Its IUPAC name is (2Z)-2-(4-chlorophenyl)-6-methylhepta-2,5-dien-4-one.
| Compound Name | (2Z)-2-(4-chlorophenyl)-6-methylhepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 13153107 |
| Molecular Formula | C14H15ClO |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (2Z)-2-(4-chlorophenyl)-6-methylhepta-2,5-dien-4-one |
| SMILES | CC(C)=CC(=O)/C=C(/C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClO/c1-10(2)8-14(16)9-11(3)12-4-6-13(15)7-5-12/h4-9H,1-3H3/b11-9- |
| InChIKey | JYKZEZZCKVNXLF-LUAWRHEFSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|