About 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid
4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid (PubChem CID 5316894) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid |
| PubChem CID | 5316894 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid |
| SMILES | CC(C)=CC(=O)/C=C(\C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H16O3/c1-10(2)8-14(16)9-11(3)12-4-6-13(7-5-12)15(17)18/h4-9H,1-3H3,(H,17,18)/b11-9+ |
| InChIKey | YDSABZMFSRCMEP-PKNBQFBNSA-N |
| XLogP | 3.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid?
The IUPAC name of 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid (CID 5316894) is 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid.
What is the SMILES notation for 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid?
The canonical SMILES for 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid is CC(C)=CC(=O)/C=C(\C)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid?
The InChIKey is YDSABZMFSRCMEP-PKNBQFBNSA-N. The full InChI is InChI=1S/C15H16O3/c1-10(2)8-14(16)9-11(3)12-4-6-13(7-5-12)15(17)18/h4-9H,1-3H3,(H,17,18)/b11-9+.
What are the key properties of 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid?
4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid has a molecular weight of 244.29 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-6-methyl-4-oxohepta-2,5-dien-2-yl]benzoic acid is sourced from PubChem (CID 5316894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).