C15H19N4O+ — CID 91014224
4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-2-methoxy-5-methylaniline (PubChem CID 91014224) has the molecular formula C15H19N4O+ and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-2-methoxy-5-methylaniline.
| Compound Name | 4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-2-methoxy-5-methylaniline |
|---|---|
| PubChem CID | 91014224 |
| Molecular Formula | C15H19N4O+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[(1,5-dimethylpyridin-1-ium-2-yl)diazenyl]-2-methoxy-5-methylaniline |
| SMILES | COc1cc(/N=N/c2ccc(C)c[n+]2C)c(C)cc1N |
| InChI | InChI=1S/C15H18N4O/c1-10-5-6-15(19(3)9-10)18-17-13-8-14(20-4)12(16)7-11(13)2/h5-9,16H,1-4H3/p+1 |
| InChIKey | AAMKKRHINBKFJI-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|