C16H17N3O3 — CID 171057593
(5-methoxy-2,4-dimethylphenyl)-(4-methyl-2-nitrophenyl)diazene (PubChem CID 171057593) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (5-methoxy-2,4-dimethylphenyl)-(4-methyl-2-nitrophenyl)diazene.
| Compound Name | (5-methoxy-2,4-dimethylphenyl)-(4-methyl-2-nitrophenyl)diazene |
|---|---|
| PubChem CID | 171057593 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5-methoxy-2,4-dimethylphenyl)-(4-methyl-2-nitrophenyl)diazene |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2[N+](=O)[O-])c(C)cc1C |
| InChI | InChI=1S/C16H17N3O3/c1-10-5-6-13(15(7-10)19(20)21)17-18-14-9-16(22-4)12(3)8-11(14)2/h5-9H,1-4H3/b18-17+ |
| InChIKey | URFYXMDEIQYWFF-ISLYRVAYSA-N |
| XLogP | 4.94 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|