C26H28N8O3 — CID 134530520
[4-(1-azidopentan-3-yl)phenyl]-[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazene (PubChem CID 134530520) has the molecular formula C26H28N8O3 and a molecular weight of 500.56 g/mol. Its IUPAC name is [4-(1-azidopentan-3-yl)phenyl]-[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazene.
| Compound Name | [4-(1-azidopentan-3-yl)phenyl]-[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazene |
|---|---|
| PubChem CID | 134530520 |
| Molecular Formula | C26H28N8O3 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | [4-(1-azidopentan-3-yl)phenyl]-[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazene |
| SMILES | CCC(CCN=[N+]=[N-])c1ccc(/N=N/c2cc(C)c(/N=N/c3ccc(C)cc3[N+](=O)[O-])cc2OC)cc1 |
| InChI | InChI=1S/C26H28N8O3/c1-5-19(12-13-28-33-27)20-7-9-21(10-8-20)29-32-24-15-18(3)23(16-26(24)37-4)31-30-22-11-6-17(2)14-25(22)34(35)36/h6-11,14-16,19H,5,12-13H2,1-4H3/b31-30+,32-29+ |
| InChIKey | NWAPBNWJNDGNIW-JUVFNHDTSA-N |
| XLogP | 9.25 |
| TPSA | 150.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|