C15H16N4O3 — CID 18987570
2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]aniline (PubChem CID 18987570) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]aniline.
| Compound Name | 2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 18987570 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]aniline |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2[N+](=O)[O-])c(C)cc1N |
| InChI | InChI=1S/C15H16N4O3/c1-9-4-5-12(14(6-9)19(20)21)17-18-13-8-15(22-3)11(16)7-10(13)2/h4-8H,16H2,1-3H3/b18-17+ |
| InChIKey | VOYNKHKVVYBZQC-ISLYRVAYSA-N |
| XLogP | 4.22 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|