C18H25N3O4S — CID 135453648
N,N-diethyl-3-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)diazenyl]benzenesulfonamide (PubChem CID 135453648) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N,N-diethyl-3-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)diazenyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135453648 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N,N-diethyl-3-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)diazenyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(/N=N/C2=C(O)CC(C)(C)CC2=O)c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-5-21(6-2)26(24,25)14-9-7-8-13(10-14)19-20-17-15(22)11-18(3,4)12-16(17)23/h7-10,22H,5-6,11-12H2,1-4H3/b20-19+ |
| InChIKey | YHGYANAGVRPLIP-FMQUCBEESA-N |
| XLogP | 3.96 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|