C18H25N5O5S — CID 135672500
3-[(1,3-diethyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-N,N-diethylbenzenesulfonamide (PubChem CID 135672500) has the molecular formula C18H25N5O5S and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-[(1,3-diethyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[(1,3-diethyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135672500 |
| Molecular Formula | C18H25N5O5S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-[(1,3-diethyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)diazenyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(/N=N/c2c(O)n(CC)c(=O)n(CC)c2=O)c1 |
| InChI | InChI=1S/C18H25N5O5S/c1-5-21(6-2)29(27,28)14-11-9-10-13(12-14)19-20-15-16(24)22(7-3)18(26)23(8-4)17(15)25/h9-12,24H,5-8H2,1-4H3/b20-19+ |
| InChIKey | DHTHKCVYLFQXBV-FMQUCBEESA-N |
| XLogP | 2.20 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|