C27H27N5O9S3 — CID 158774030
5-amino-6-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-[(3-ethylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 158774030) has the molecular formula C27H27N5O9S3 and a molecular weight of 661.74 g/mol. Its IUPAC name is 5-amino-6-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-[(3-ethylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-6-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-[(3-ethylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 158774030 |
| Molecular Formula | C27H27N5O9S3 |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.10 |
| IUPAC Name | 5-amino-6-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-[(3-ethylsulfonylphenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCS(=O)(=O)c1cccc(/N=N/c2c(S(=O)(=O)O)cc3ccc(/N=N/c4cc(S(=O)(=O)CC)ccc4OC)c(N)c3c2O)c1 |
| InChI | InChI=1S/C27H27N5O9S3/c1-4-42(34,35)18-8-6-7-17(14-18)29-32-26-23(44(38,39)40)13-16-9-11-20(25(28)24(16)27(26)33)30-31-21-15-19(43(36,37)5-2)10-12-22(21)41-3/h6-15,33H,4-5,28H2,1-3H3,(H,38,39,40)/b31-30+,32-29+ |
| InChIKey | TYIIVRKMJROYPR-JUVFNHDTSA-N |
| XLogP | 5.80 |
| TPSA | 227.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|