C31H35N5O12S3 — CID 157326236
4-amino-3-[(2,5-dimethoxy-4-propylsulfonylphenyl)diazenyl]-6-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid (PubChem CID 157326236) has the molecular formula C31H35N5O12S3 and a molecular weight of 765.84 g/mol. Its IUPAC name is 4-amino-3-[(2,5-dimethoxy-4-propylsulfonylphenyl)diazenyl]-6-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 4-amino-3-[(2,5-dimethoxy-4-propylsulfonylphenyl)diazenyl]-6-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 157326236 |
| Molecular Formula | C31H35N5O12S3 |
| Molecular Weight | 765.84 g/mol |
| Exact Mass | 765.14 |
| IUPAC Name | 4-amino-3-[(2,5-dimethoxy-4-propylsulfonylphenyl)diazenyl]-6-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCCS(=O)(=O)c1cc(OC)c(/N=N/c2c(S(=O)(=O)O)cc3ccc(/N=N/c4cc(OC)c(S(=O)(=O)CC)cc4OC)c(O)c3c2N)cc1OC |
| InChI | InChI=1S/C31H35N5O12S3/c1-7-11-50(40,41)26-16-22(46-4)20(14-24(26)48-6)35-36-30-27(51(42,43)44)12-17-9-10-18(31(37)28(17)29(30)32)33-34-19-13-23(47-5)25(15-21(19)45-3)49(38,39)8-2/h9-10,12-16,37H,7-8,11,32H2,1-6H3,(H,42,43,44)/b34-33+,36-35+ |
| InChIKey | AWQFAESPORDJSO-WXBFSDFVSA-N |
| XLogP | 6.22 |
| TPSA | 255.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|