C31H35N5O9S2 — CID 136985428
6-(ethylamino)-5-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-2-[(4-ethylsulfonyl-2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol (PubChem CID 136985428) has the molecular formula C31H35N5O9S2 and a molecular weight of 685.78 g/mol. Its IUPAC name is 6-(ethylamino)-5-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-2-[(4-ethylsulfonyl-2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol.
| Compound Name | 6-(ethylamino)-5-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-2-[(4-ethylsulfonyl-2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136985428 |
| Molecular Formula | C31H35N5O9S2 |
| Molecular Weight | 685.78 g/mol |
| Exact Mass | 685.19 |
| IUPAC Name | 6-(ethylamino)-5-[(4-ethylsulfonyl-2,5-dimethoxyphenyl)diazenyl]-2-[(4-ethylsulfonyl-2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol |
| SMILES | CCNc1ccc2c(O)c(/N=N/c3cc(OC)c(S(=O)(=O)CC)cc3O)ccc2c1/N=N/c1cc(OC)c(S(=O)(=O)CC)cc1OC |
| InChI | InChI=1S/C31H35N5O9S2/c1-7-32-20-12-11-19-18(30(20)36-35-23-15-27(45-6)29(17-25(23)43-4)47(41,42)9-3)10-13-21(31(19)38)33-34-22-14-26(44-5)28(16-24(22)37)46(39,40)8-2/h10-17,32,37-38H,7-9H2,1-6H3/b34-33+,36-35+ |
| InChIKey | VVBCIFLUCCXDBZ-WXBFSDFVSA-N |
| XLogP | 7.13 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|