C16H18N2O5S — CID 21184626
1-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea (PubChem CID 21184626) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 1-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 21184626 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C16H18N2O5S/c1-3-24(21,22)13-8-9-15(19)14(10-13)18-16(20)17-11-4-6-12(23-2)7-5-11/h4-10,19H,3H2,1-2H3,(H2,17,18,20) |
| InChIKey | FCCIJWFRTBQTPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|