C19H23NO6S — CID 31618396
N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-(4-methoxyphenoxy)butanamide (PubChem CID 31618396) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 31618396 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-(4-methoxyphenoxy)butanamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CCCOc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H23NO6S/c1-3-27(23,24)16-10-11-18(21)17(13-16)20-19(22)5-4-12-26-15-8-6-14(25-2)7-9-15/h6-11,13,21H,3-5,12H2,1-2H3,(H,20,22) |
| InChIKey | ULBVRLMCQYLDNA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|