C19H22ClNO5S — CID 35978441
4-(4-chloro-2-methylphenoxy)-N-(5-ethylsulfonyl-2-hydroxyphenyl)butanamide (PubChem CID 35978441) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-(5-ethylsulfonyl-2-hydroxyphenyl)butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-(5-ethylsulfonyl-2-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 35978441 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-(5-ethylsulfonyl-2-hydroxyphenyl)butanamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CCCOc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C19H22ClNO5S/c1-3-27(24,25)15-7-8-17(22)16(12-15)21-19(23)5-4-10-26-18-9-6-14(20)11-13(18)2/h6-9,11-12,22H,3-5,10H2,1-2H3,(H,21,23) |
| InChIKey | NFRAJTJJCYEPOM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|