C16H14Cl3NO5S — CID 35978496
N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 35978496) has the molecular formula C16H14Cl3NO5S and a molecular weight of 438.72 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 35978496 |
| Molecular Formula | C16H14Cl3NO5S |
| Molecular Weight | 438.72 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)COc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl3NO5S/c1-2-26(23,24)9-3-4-14(21)13(5-9)20-16(22)8-25-15-7-11(18)10(17)6-12(15)19/h3-7,21H,2,8H2,1H3,(H,20,22) |
| InChIKey | GCMFYFWOXHAISN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|