C13H17NO4S — CID 51108082
N-(5-ethylsulfonyl-2-hydroxyphenyl)pent-4-enamide (PubChem CID 51108082) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)pent-4-enamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 51108082 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)pent-4-enamide |
| SMILES | C=CCCC(=O)Nc1cc(S(=O)(=O)CC)ccc1O |
| InChI | InChI=1S/C13H17NO4S/c1-3-5-6-13(16)14-11-9-10(7-8-12(11)15)19(17,18)4-2/h3,7-9,15H,1,4-6H2,2H3,(H,14,16) |
| InChIKey | BQVFYINFEKAMQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|